![1-[2-(4-Chlorophenyl)-1,3-thiazol-5-yl]-1-ethanone (CAS: 57560-99-3) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0680494.png "1-[2-(4-Chlorophenyl)-1,3-thiazol-5-yl]-1-ethanone chemical structure")
1-[2-(4-Chlorophenyl)-1,3-thiazol-5-yl]-1-ethanone
Catalog No: FT-0680494
CAS No: 57560-99-3
- Chemical Name: 1-[2-(4-Chlorophenyl)-1,3-thiazol-5-yl]-1-ethanone
- Molecular Formula: C11H8ClNOS
- Molecular Weight: 237.71
- InChI Key: CAEMSQJRTZSWLF-UHFFFAOYSA-N
- InChI: InChI=1S/C11H8ClNOS/c1-7(14)10-6-13-11(15-10)8-2-4-9(12)5-3-8/h2-6H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 237.70500 |
|---|---|
| Melting_Point: | 150-152ºC |
| Flash_Point: | 182.5ºC |
| Product_Name: | 1-[2-(4-chlorophenyl)-1,3-thiazol-5-yl]ethanone |
| Density: | 1.314g/cm3 |
| CAS: | 57560-99-3 |
| Bolling_Point: | 378.1ºC at 760mmHg |
| MF: | C11H8ClNOS |
| FW: | 237.70500 |
|---|---|
| Melting_Point: | 150-152ºC |
| LogP: | 3.66610 |
| Bolling_Point: | 378.1ºC at 760mmHg |
| Exact_Mass: | 237.00200 |
| PSA: | 58.20000 |
| Density: | 1.314g/cm3 |
| Refractive_Index: | 1.604 |
| Flash_Point: | 182.5ºC |
| MF: | C11H8ClNOS |
| HS_Code: | 2934100090 |
|---|
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)